5,10,15,20-Tetrakis(p-tolyl)porphyrin  (Synonyms: 5,10,15,20-Tetra-p-tolyl-21H,23H-porphine)

5,10,15,20-Tetrakis(p-tolyl)porphyrin (TTP) is an organic compound belonging to the class of porphyrins, a cyclic molecule composed of four pyrrole rings linked together. TTP is a synthetic porphyrin commonly used as a sensitizer for dye-sensitized solar cells and a catalyst for organic reactions. Due to its unique structure, TTP has a series of interesting properties, including at specific wavelengths and its potential as a catalyst for various chemical reactions. In dye-sensitized solar cells, TTPs help convert sunlight into electricity by absorbing photons and transferring electrons to the semiconductor layer of the device. In organic chemistry, TTP is often used as a catalyst for various organic compounds in reactions such as oxidation and reduction. Its ability to selectively bind certain substrates makes it a useful tool for synthesizing complex molecules and studying their properties.

5,10,15,20-Tetrakis(p-tolyl)porphyrin is a biochemical reagent that can be used as a biological material or organic compound for life science related research.

MedChemExpress (MCE) has not independently confirmed the accuracy of these methods. They are for reference only.

670.84

C₄₈H₃₈N₄

14527-51-6

Solid

Pale purple to purple

CC1=CC=C(/C2=C3C=CC(/C(C4=CC=C(C)C=C4)=C(N/5)/C=CC5=C(C6=CC=C(C)C=C6)\C7=N/C(C=C7)=C(C8=CC=C(C)C=C8)\C9=CC=C2N9)=N\3)C=C1

Room temperature in continental US; may vary elsewhere.

4°C, protect from light, stored under nitrogen

*In solvent : -80°C, 6 months; -20°C, 1 month (protect from light, stored under nitrogen)