1. Anti-infection
  2. Parasite
  3. 80262-44-8

80262-44-8

Cucurbituril Chemical Structure

80262-44-8

Chemical Structure

  • Cucurbituril
  • CAS No: 80262-44-8
    Formula: C36H36N24O12
    Molecular Weight: 996.82
  • InChIKey: MSBXTPRURXJCPF-UHFFFAOYSA-N
  • SMILES: O=C1N2C(N3CN(C4=O)C(C5N6CN(C7=O)C(C8N7CN9C%10N%11CN%128)N(C%12=O)CN45)N(C6=O)C2)C(N1CN(C%13=O)C(C%14N%15CN(C%16=O)C(C%17N%16CN(C%18%10)C%11=O)N(C(N%17CN%18C9=O)=O)CN%13%14)N(C%15=O)C%19)N%19C3=O

Biological Activity: Cucurbituril is a container molecule resembling a hollow pumpkin, with two identical inlets at each end and a hydrophobic cavity in the middle. Cucurbiturils have unique chemical properties that allow them to selectively encapsulate guest molecules such as drugs or catalysts within their cavities, shielding them from the surrounding environment. Cucurbituril has important potential applications in various fields such as drug delivery, catalysis and materials science.

Cat. No. Product Name Purity Description
HY-W130354 Cucurbituril ≥97.0% Cucurbituril is a container molecule resembling a hollow pumpkin, with two identical inlets at each end and a hydrophobic cavity in the middle. Cucurbiturils have unique chemical properties that allow them to selectively encapsulate guest molecules such as drugs or catalysts within their cavities, shielding them from the surrounding environment. Cucurbituril has important potential applications in various fields such as drug delivery, catalysis and materials science.

Keywords:

Cucurbituril