2. Natural Products
  3. Plants Flavonoids
  4. Berberidaceae Flavones
  5. Sinopodophyllum hexandrum (Royle) Ying
  6. 1369959-47-6

1369959-47-6

Sinopodophylline B Chemical Structure

1369959-47-6

Chemical Structure

  • Sinopodophylline B
  • CAS No: 1369959-47-6
    Formula: C21H20O7
    Molecular Weight: 384.38
  • InChIKey: VUWRPEGSZKAYCY-UHFFFAOYSA-N
  • SMILES: COC1=C(C2=CC=C(O)C(O)=C2)OC3=C(C/C=C(C)\C)C(O)=CC(O)=C3C1=O

Biological Activity: Sinopodophylline B (compound 2) is a flavonoid glycoside compound that is cytotoxic to breast cancer cells. For example, the IC50 of Sinopodophylline B is 1.5 μM (T47D) and 44.2 μM (MDA-MB-231), respectively[1].

Cat. No. Product Name Purity Description
HY-N13118 Sinopodophylline B Sinopodophylline B (compound 2) is a flavonoid glycoside compound that is cytotoxic to breast cancer cells. For example, the IC50 of Sinopodophylline B is 1.5 μM (T47D) and 44.2 μM (MDA-MB-231), respectively.

References

[1]. Flavonoids isolated from Sinopodophylli Fructus and their bioactivities against human breast cancer cells

Keywords:

Sinopodophylline B